C25H33Cl2N3O4S — CID 132736669
N-[1-(butylamino)-1-oxopropan-2-yl]-N-[(2,6-dichlorophenyl)methyl]-4-(N-methylsulfonylanilino)butanamide (PubChem CID 132736669) has the molecular formula C25H33Cl2N3O4S and a molecular weight of 542.53 g/mol. Its IUPAC name is N-[1-(butylamino)-1-oxopropan-2-yl]-N-[(2,6-dichlorophenyl)methyl]-4-(N-methylsulfonylanilino)butanamide.
| Compound Name | N-[1-(butylamino)-1-oxopropan-2-yl]-N-[(2,6-dichlorophenyl)methyl]-4-(N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 132736669 |
| Molecular Formula | C25H33Cl2N3O4S |
| Molecular Weight | 542.53 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | N-[1-(butylamino)-1-oxopropan-2-yl]-N-[(2,6-dichlorophenyl)methyl]-4-(N-methylsulfonylanilino)butanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1c(Cl)cccc1Cl)C(=O)CCCN(c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C25H33Cl2N3O4S/c1-4-5-16-28-25(32)19(2)29(18-21-22(26)13-9-14-23(21)27)24(31)15-10-17-30(35(3,33)34)20-11-7-6-8-12-20/h6-9,11-14,19H,4-5,10,15-18H2,1-3H3,(H,28,32) |
| InChIKey | SZXCHUPPJDVREL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|