C24H28Cl4N2O2S — CID 132738539
N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[(2,4-dichlorophenyl)methylsulfanyl]acetyl]amino]butanamide (PubChem CID 132738539) has the molecular formula C24H28Cl4N2O2S and a molecular weight of 550.38 g/mol. Its IUPAC name is N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[(2,4-dichlorophenyl)methylsulfanyl]acetyl]amino]butanamide.
| Compound Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[(2,4-dichlorophenyl)methylsulfanyl]acetyl]amino]butanamide |
|---|---|
| PubChem CID | 132738539 |
| Molecular Formula | C24H28Cl4N2O2S |
| Molecular Weight | 550.38 g/mol |
| Exact Mass | 548.06 |
| IUPAC Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-[(2,4-dichlorophenyl)methylsulfanyl]acetyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CSCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H28Cl4N2O2S/c1-3-5-10-29-24(32)22(4-2)30(13-16-6-9-19(26)21(28)11-16)23(31)15-33-14-17-7-8-18(25)12-20(17)27/h6-9,11-12,22H,3-5,10,13-15H2,1-2H3,(H,29,32) |
| InChIKey | OAUAWQOELRIQEJ-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.38 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|