C25H34BrN3O4S — CID 132739153
2-[[2-(4-bromo-3-methyl-N-methylsulfonylanilino)acetyl]-[(2-methylphenyl)methyl]amino]-N-butylpropanamide (PubChem CID 132739153) has the molecular formula C25H34BrN3O4S and a molecular weight of 552.54 g/mol. Its IUPAC name is 2-[[2-(4-bromo-3-methyl-N-methylsulfonylanilino)acetyl]-[(2-methylphenyl)methyl]amino]-N-butylpropanamide.
| Compound Name | 2-[[2-(4-bromo-3-methyl-N-methylsulfonylanilino)acetyl]-[(2-methylphenyl)methyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 132739153 |
| Molecular Formula | C25H34BrN3O4S |
| Molecular Weight | 552.54 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | 2-[[2-(4-bromo-3-methyl-N-methylsulfonylanilino)acetyl]-[(2-methylphenyl)methyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccccc1C)C(=O)CN(c1ccc(Br)c(C)c1)S(C)(=O)=O |
| InChI | InChI=1S/C25H34BrN3O4S/c1-6-7-14-27-25(31)20(4)28(16-21-11-9-8-10-18(21)2)24(30)17-29(34(5,32)33)22-12-13-23(26)19(3)15-22/h8-13,15,20H,6-7,14,16-17H2,1-5H3,(H,27,31) |
| InChIKey | IAONJJUKGCZFKE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|