C26H35Cl2N3O4S — CID 132740262
N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(2,5-dimethyl-N-methylsulfonylanilino)acetyl]amino]butanamide (PubChem CID 132740262) has the molecular formula C26H35Cl2N3O4S and a molecular weight of 556.56 g/mol. Its IUPAC name is N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(2,5-dimethyl-N-methylsulfonylanilino)acetyl]amino]butanamide.
| Compound Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(2,5-dimethyl-N-methylsulfonylanilino)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 132740262 |
| Molecular Formula | C26H35Cl2N3O4S |
| Molecular Weight | 556.56 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(2,5-dimethyl-N-methylsulfonylanilino)acetyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN(c1cc(C)ccc1C)S(C)(=O)=O |
| InChI | InChI=1S/C26H35Cl2N3O4S/c1-6-8-13-29-26(33)23(7-2)30(16-20-11-12-21(27)22(28)15-20)25(32)17-31(36(5,34)35)24-14-18(3)9-10-19(24)4/h9-12,14-15,23H,6-8,13,16-17H2,1-5H3,(H,29,33) |
| InChIKey | KQWZRCTUAXETDK-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.56 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|