C28H40ClN3O5S — CID 132742421
N-butyl-2-[4-(5-chloro-2-methyl-N-methylsulfonylanilino)butanoyl-[(3-methoxyphenyl)methyl]amino]butanamide (PubChem CID 132742421) has the molecular formula C28H40ClN3O5S and a molecular weight of 566.16 g/mol. Its IUPAC name is N-butyl-2-[4-(5-chloro-2-methyl-N-methylsulfonylanilino)butanoyl-[(3-methoxyphenyl)methyl]amino]butanamide.
| Compound Name | N-butyl-2-[4-(5-chloro-2-methyl-N-methylsulfonylanilino)butanoyl-[(3-methoxyphenyl)methyl]amino]butanamide |
|---|---|
| PubChem CID | 132742421 |
| Molecular Formula | C28H40ClN3O5S |
| Molecular Weight | 566.16 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | N-butyl-2-[4-(5-chloro-2-methyl-N-methylsulfonylanilino)butanoyl-[(3-methoxyphenyl)methyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1cccc(OC)c1)C(=O)CCCN(c1cc(Cl)ccc1C)S(C)(=O)=O |
| InChI | InChI=1S/C28H40ClN3O5S/c1-6-8-16-30-28(34)25(7-2)31(20-22-11-9-12-24(18-22)37-4)27(33)13-10-17-32(38(5,35)36)26-19-23(29)15-14-21(26)3/h9,11-12,14-15,18-19,25H,6-8,10,13,16-17,20H2,1-5H3,(H,30,34) |
| InChIKey | AWSURYUZNPCZGC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.16 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|