C24H30Cl3N3O5S — CID 132745262
2-[(3-methoxyphenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-propan-2-ylbutanamide (PubChem CID 132745262) has the molecular formula C24H30Cl3N3O5S and a molecular weight of 578.95 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-propan-2-ylbutanamide.
| Compound Name | 2-[(3-methoxyphenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 132745262 |
| Molecular Formula | C24H30Cl3N3O5S |
| Molecular Weight | 578.95 g/mol |
| Exact Mass | 577.10 |
| IUPAC Name | 2-[(3-methoxyphenyl)methyl-[2-(2,4,5-trichloro-N-methylsulfonylanilino)acetyl]amino]-N-propan-2-ylbutanamide |
| SMILES | CCC(C(=O)NC(C)C)N(Cc1cccc(OC)c1)C(=O)CN(c1cc(Cl)c(Cl)cc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C24H30Cl3N3O5S/c1-6-21(24(32)28-15(2)3)29(13-16-8-7-9-17(10-16)35-4)23(31)14-30(36(5,33)34)22-12-19(26)18(25)11-20(22)27/h7-12,15,21H,6,13-14H2,1-5H3,(H,28,32) |
| InChIKey | WDXKPJXFNIVEGB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.95 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|