About 1-(bromomethyl)-4-(1,1-dimethoxy-2,2-dimethylpropyl)benzene
1-(bromomethyl)-4-(1,1-dimethoxy-2,2-dimethylpropyl)benzene (PubChem CID 13274605) has the molecular formula C14H21BrO2
and a molecular weight of 301.22 g/mol. Its IUPAC name is 1-(bromomethyl)-4-(1,1-dimethoxy-2,2-dimethylpropyl)benzene.
Molecular Properties
| Compound Name | 1-(bromomethyl)-4-(1,1-dimethoxy-2,2-dimethylpropyl)benzene |
| PubChem CID | 13274605 |
| Molecular Formula | C14H21BrO2 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 1-(bromomethyl)-4-(1,1-dimethoxy-2,2-dimethylpropyl)benzene |
| SMILES | COC(OC)(c1ccc(CBr)cc1)C(C)(C)C |
| InChI | InChI=1S/C14H21BrO2/c1-13(2,3)14(16-4,17-5)12-8-6-11(10-15)7-9-12/h6-9H,10H2,1-5H3 |
| InChIKey | PWBIPGXRAIBMDX-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(bromomethyl)-4-(1,1-dimethoxy-2,2-dimethylpropyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(bromomethyl)-4-(1,1-dimethoxy-2,2-dimethylpropyl)benzene?
The IUPAC name of 1-(bromomethyl)-4-(1,1-dimethoxy-2,2-dimethylpropyl)benzene (CID 13274605) is 1-(bromomethyl)-4-(1,1-dimethoxy-2,2-dimethylpropyl)benzene.
What is the SMILES notation for 1-(bromomethyl)-4-(1,1-dimethoxy-2,2-dimethylpropyl)benzene?
The canonical SMILES for 1-(bromomethyl)-4-(1,1-dimethoxy-2,2-dimethylpropyl)benzene is COC(OC)(c1ccc(CBr)cc1)C(C)(C)C.
What is the InChIKey of 1-(bromomethyl)-4-(1,1-dimethoxy-2,2-dimethylpropyl)benzene?
The InChIKey is PWBIPGXRAIBMDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21BrO2/c1-13(2,3)14(16-4,17-5)12-8-6-11(10-15)7-9-12/h6-9H,10H2,1-5H3.
What are the key properties of 1-(bromomethyl)-4-(1,1-dimethoxy-2,2-dimethylpropyl)benzene?
1-(bromomethyl)-4-(1,1-dimethoxy-2,2-dimethylpropyl)benzene has a molecular weight of 301.22 g/mol, XLogP of 4.07, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(bromomethyl)-4-(1,1-dimethoxy-2,2-dimethylpropyl)benzene is sourced from PubChem (CID 13274605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).