C13H17NO3 — CID 13274736
6-(cyclopropylamino)-5,6,7,8-tetrahydronaphthalene-1,2,5-triol (PubChem CID 13274736) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 6-(cyclopropylamino)-5,6,7,8-tetrahydronaphthalene-1,2,5-triol.
| Compound Name | 6-(cyclopropylamino)-5,6,7,8-tetrahydronaphthalene-1,2,5-triol |
|---|---|
| PubChem CID | 13274736 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 6-(cyclopropylamino)-5,6,7,8-tetrahydronaphthalene-1,2,5-triol |
| SMILES | Oc1ccc2c(c1O)CCC(NC1CC1)C2O |
| InChI | InChI=1S/C13H17NO3/c15-11-6-4-8-9(13(11)17)3-5-10(12(8)16)14-7-1-2-7/h4,6-7,10,12,14-17H,1-3,5H2 |
| InChIKey | IGXLZZRHBMDIAX-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|