C34H37N3O5S — CID 132750075
2-[[2-[N-(benzenesulfonyl)-4-phenoxyanilino]acetyl]-benzylamino]-N-tert-butylpropanamide (PubChem CID 132750075) has the molecular formula C34H37N3O5S and a molecular weight of 599.75 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-4-phenoxyanilino]acetyl]-benzylamino]-N-tert-butylpropanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-4-phenoxyanilino]acetyl]-benzylamino]-N-tert-butylpropanamide |
|---|---|
| PubChem CID | 132750075 |
| Molecular Formula | C34H37N3O5S |
| Molecular Weight | 599.75 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-4-phenoxyanilino]acetyl]-benzylamino]-N-tert-butylpropanamide |
| SMILES | CC(C(=O)NC(C)(C)C)N(Cc1ccccc1)C(=O)CN(c1ccc(Oc2ccccc2)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C34H37N3O5S/c1-26(33(39)35-34(2,3)4)36(24-27-14-8-5-9-15-27)32(38)25-37(43(40,41)31-18-12-7-13-19-31)28-20-22-30(23-21-28)42-29-16-10-6-11-17-29/h5-23,26H,24-25H2,1-4H3,(H,35,39) |
| InChIKey | NRQIWHUYZSWNAY-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.75 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |