C29H33Cl2N3O5S — CID 132751711
2-[[2-[N-(benzenesulfonyl)-3,4-dichloroanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butylpropanamide (PubChem CID 132751711) has the molecular formula C29H33Cl2N3O5S and a molecular weight of 606.57 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-3,4-dichloroanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butylpropanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-3,4-dichloroanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 132751711 |
| Molecular Formula | C29H33Cl2N3O5S |
| Molecular Weight | 606.57 g/mol |
| Exact Mass | 605.15 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-3,4-dichloroanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1cccc(OC)c1)C(=O)CN(c1ccc(Cl)c(Cl)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H33Cl2N3O5S/c1-4-5-16-32-29(36)21(2)33(19-22-10-9-11-24(17-22)39-3)28(35)20-34(23-14-15-26(30)27(31)18-23)40(37,38)25-12-7-6-8-13-25/h6-15,17-18,21H,4-5,16,19-20H2,1-3H3,(H,32,36) |
| InChIKey | SOLPBSKKPDODCF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|