C34H45N3O5S — CID 132751895
N-butyl-2-[(4-methoxyphenyl)methyl-[2-(N-(4-methylphenyl)sulfonyl-4-propan-2-ylanilino)acetyl]amino]butanamide (PubChem CID 132751895) has the molecular formula C34H45N3O5S and a molecular weight of 607.82 g/mol. Its IUPAC name is N-butyl-2-[(4-methoxyphenyl)methyl-[2-(N-(4-methylphenyl)sulfonyl-4-propan-2-ylanilino)acetyl]amino]butanamide.
| Compound Name | N-butyl-2-[(4-methoxyphenyl)methyl-[2-(N-(4-methylphenyl)sulfonyl-4-propan-2-ylanilino)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 132751895 |
| Molecular Formula | C34H45N3O5S |
| Molecular Weight | 607.82 g/mol |
| Exact Mass | 607.31 |
| IUPAC Name | N-butyl-2-[(4-methoxyphenyl)methyl-[2-(N-(4-methylphenyl)sulfonyl-4-propan-2-ylanilino)acetyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(OC)cc1)C(=O)CN(c1ccc(C(C)C)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C34H45N3O5S/c1-7-9-22-35-34(39)32(8-2)36(23-27-12-18-30(42-6)19-13-27)33(38)24-37(29-16-14-28(15-17-29)25(3)4)43(40,41)31-20-10-26(5)11-21-31/h10-21,25,32H,7-9,22-24H2,1-6H3,(H,35,39) |
| InChIKey | DUGINPQKZPJSTK-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.82 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|