C29H32Cl2FN3O4S — CID 132752036
N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(4-fluoro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]propanamide (PubChem CID 132752036) has the molecular formula C29H32Cl2FN3O4S and a molecular weight of 608.56 g/mol. Its IUPAC name is N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(4-fluoro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]propanamide.
| Compound Name | N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(4-fluoro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 132752036 |
| Molecular Formula | C29H32Cl2FN3O4S |
| Molecular Weight | 608.56 g/mol |
| Exact Mass | 607.15 |
| IUPAC Name | N-butyl-2-[(2,4-dichlorophenyl)methyl-[2-(4-fluoro-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(Cl)cc1Cl)C(=O)CN(c1ccc(F)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C29H32Cl2FN3O4S/c1-4-5-16-33-29(37)21(3)34(18-22-8-9-23(30)17-27(22)31)28(36)19-35(25-12-10-24(32)11-13-25)40(38,39)26-14-6-20(2)7-15-26/h6-15,17,21H,4-5,16,18-19H2,1-3H3,(H,33,37) |
| InChIKey | FFVVCDDZXRNRLS-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.56 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|