About [2-methyl-2-(2-pentylsulfanylethyl)-1,3-dioxolan-4-yl]methanol
[2-methyl-2-(2-pentylsulfanylethyl)-1,3-dioxolan-4-yl]methanol (PubChem CID 13275290) has the molecular formula C12H24O3S
and a molecular weight of 248.39 g/mol. Its IUPAC name is [2-methyl-2-(2-pentylsulfanylethyl)-1,3-dioxolan-4-yl]methanol.
Molecular Properties
| Compound Name | [2-methyl-2-(2-pentylsulfanylethyl)-1,3-dioxolan-4-yl]methanol |
| PubChem CID | 13275290 |
| Molecular Formula | C12H24O3S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | [2-methyl-2-(2-pentylsulfanylethyl)-1,3-dioxolan-4-yl]methanol |
| SMILES | CCCCCSCCC1(C)OCC(CO)O1 |
| InChI | InChI=1S/C12H24O3S/c1-3-4-5-7-16-8-6-12(2)14-10-11(9-13)15-12/h11,13H,3-10H2,1-2H3 |
| InChIKey | DBZGCDYCFRPZBA-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-methyl-2-(2-pentylsulfanylethyl)-1,3-dioxolan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methyl-2-(2-pentylsulfanylethyl)-1,3-dioxolan-4-yl]methanol?
The IUPAC name of [2-methyl-2-(2-pentylsulfanylethyl)-1,3-dioxolan-4-yl]methanol (CID 13275290) is [2-methyl-2-(2-pentylsulfanylethyl)-1,3-dioxolan-4-yl]methanol.
What is the SMILES notation for [2-methyl-2-(2-pentylsulfanylethyl)-1,3-dioxolan-4-yl]methanol?
The canonical SMILES for [2-methyl-2-(2-pentylsulfanylethyl)-1,3-dioxolan-4-yl]methanol is CCCCCSCCC1(C)OCC(CO)O1.
What is the InChIKey of [2-methyl-2-(2-pentylsulfanylethyl)-1,3-dioxolan-4-yl]methanol?
The InChIKey is DBZGCDYCFRPZBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O3S/c1-3-4-5-7-16-8-6-12(2)14-10-11(9-13)15-12/h11,13H,3-10H2,1-2H3.
What are the key properties of [2-methyl-2-(2-pentylsulfanylethyl)-1,3-dioxolan-4-yl]methanol?
[2-methyl-2-(2-pentylsulfanylethyl)-1,3-dioxolan-4-yl]methanol has a molecular weight of 248.39 g/mol, XLogP of 2.42, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methyl-2-(2-pentylsulfanylethyl)-1,3-dioxolan-4-yl]methanol is sourced from PubChem (CID 13275290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).