C12H19NO2 — CID 13275408
N-(1,3-dimethoxypropan-2-yl)-3-methylaniline (PubChem CID 13275408) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is N-(1,3-dimethoxypropan-2-yl)-3-methylaniline.
| Compound Name | N-(1,3-dimethoxypropan-2-yl)-3-methylaniline |
|---|---|
| PubChem CID | 13275408 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | N-(1,3-dimethoxypropan-2-yl)-3-methylaniline |
| SMILES | COCC(COC)Nc1cccc(C)c1 |
| InChI | InChI=1S/C12H19NO2/c1-10-5-4-6-11(7-10)13-12(8-14-2)9-15-3/h4-7,12-13H,8-9H2,1-3H3 |
| InChIKey | BPYUEBWDIXDTSG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |