C33H43N3O7S — CID 132754913
N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetyl]-(2-phenylethyl)amino]propanamide (PubChem CID 132754913) has the molecular formula C33H43N3O7S and a molecular weight of 625.79 g/mol. Its IUPAC name is N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetyl]-(2-phenylethyl)amino]propanamide.
| Compound Name | N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetyl]-(2-phenylethyl)amino]propanamide |
|---|---|
| PubChem CID | 132754913 |
| Molecular Formula | C33H43N3O7S |
| Molecular Weight | 625.79 g/mol |
| Exact Mass | 625.28 |
| IUPAC Name | N-butyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonyl-4-ethoxyanilino)acetyl]-(2-phenylethyl)amino]propanamide |
| SMILES | CCCCNC(=O)C(C)N(CCc1ccccc1)C(=O)CN(c1ccc(OCC)cc1)S(=O)(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C33H43N3O7S/c1-6-8-21-34-33(38)25(3)35(22-20-26-12-10-9-11-13-26)32(37)24-36(27-14-16-28(17-15-27)43-7-2)44(39,40)29-18-19-30(41-4)31(23-29)42-5/h9-19,23,25H,6-8,20-22,24H2,1-5H3,(H,34,38) |
| InChIKey | YSFKDURJJMJWLA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.79 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|