C32H39Cl2N3O4S — CID 132755608
N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(3,5-dimethyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]butanamide (PubChem CID 132755608) has the molecular formula C32H39Cl2N3O4S and a molecular weight of 632.65 g/mol. Its IUPAC name is N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(3,5-dimethyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]butanamide.
| Compound Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(3,5-dimethyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]butanamide |
|---|---|
| PubChem CID | 132755608 |
| Molecular Formula | C32H39Cl2N3O4S |
| Molecular Weight | 632.65 g/mol |
| Exact Mass | 631.20 |
| IUPAC Name | N-butyl-2-[(3,4-dichlorophenyl)methyl-[2-(3,5-dimethyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]butanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN(c1cc(C)cc(C)c1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C32H39Cl2N3O4S/c1-6-8-15-35-32(39)30(7-2)36(20-25-11-14-28(33)29(34)19-25)31(38)21-37(26-17-23(4)16-24(5)18-26)42(40,41)27-12-9-22(3)10-13-27/h9-14,16-19,30H,6-8,15,20-21H2,1-5H3,(H,35,39) |
| InChIKey | KTLJHFNFKQXOBJ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.65 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|