C31H35ClF3N3O4S — CID 132756223
2-[[2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]acetyl]-[(4-methylphenyl)methyl]amino]-N-butylbutanamide (PubChem CID 132756223) has the molecular formula C31H35ClF3N3O4S and a molecular weight of 638.15 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]acetyl]-[(4-methylphenyl)methyl]amino]-N-butylbutanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]acetyl]-[(4-methylphenyl)methyl]amino]-N-butylbutanamide |
|---|---|
| PubChem CID | 132756223 |
| Molecular Formula | C31H35ClF3N3O4S |
| Molecular Weight | 638.15 g/mol |
| Exact Mass | 637.20 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]acetyl]-[(4-methylphenyl)methyl]amino]-N-butylbutanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1ccc(C)cc1)C(=O)CN(c1cc(C(F)(F)F)ccc1Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H35ClF3N3O4S/c1-4-6-18-36-30(40)27(5-2)37(20-23-14-12-22(3)13-15-23)29(39)21-38(43(41,42)25-10-8-7-9-11-25)28-19-24(31(33,34)35)16-17-26(28)32/h7-17,19,27H,4-6,18,20-21H2,1-3H3,(H,36,40) |
| InChIKey | FJGNODQDAFIHEU-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.15 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|