C30H32Cl2F3N3O4S — CID 132758006
2-[[2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-butylbutanamide (PubChem CID 132758006) has the molecular formula C30H32Cl2F3N3O4S and a molecular weight of 658.57 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-butylbutanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-butylbutanamide |
|---|---|
| PubChem CID | 132758006 |
| Molecular Formula | C30H32Cl2F3N3O4S |
| Molecular Weight | 658.57 g/mol |
| Exact Mass | 657.14 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-3-(trifluoromethyl)anilino]acetyl]-[(2,6-dichlorophenyl)methyl]amino]-N-butylbutanamide |
| SMILES | CCCCNC(=O)C(CC)N(Cc1c(Cl)cccc1Cl)C(=O)CN(c1cccc(C(F)(F)F)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H32Cl2F3N3O4S/c1-3-5-17-36-29(40)27(4-2)37(19-24-25(31)15-10-16-26(24)32)28(39)20-38(43(41,42)23-13-7-6-8-14-23)22-12-9-11-21(18-22)30(33,34)35/h6-16,18,27H,3-5,17,19-20H2,1-2H3,(H,36,40) |
| InChIKey | BTRUUHKPFQPLLX-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.57 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|