C18H16N2O2 — CID 13275802
2-(2,2-dimethyl-3-phenylaziridin-1-yl)isoindole-1,3-dione (PubChem CID 13275802) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-(2,2-dimethyl-3-phenylaziridin-1-yl)isoindole-1,3-dione.
| Compound Name | 2-(2,2-dimethyl-3-phenylaziridin-1-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 13275802 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-(2,2-dimethyl-3-phenylaziridin-1-yl)isoindole-1,3-dione |
| SMILES | CC1(C)C(c2ccccc2)N1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H16N2O2/c1-18(2)15(12-8-4-3-5-9-12)20(18)19-16(21)13-10-6-7-11-14(13)17(19)22/h3-11,15H,1-2H3 |
| InChIKey | GPHARECMEYPUPJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 40.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|