C30H36IN3O5S — CID 132758955
2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butan-2-ylbutanamide (PubChem CID 132758955) has the molecular formula C30H36IN3O5S and a molecular weight of 677.61 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butan-2-ylbutanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butan-2-ylbutanamide |
|---|---|
| PubChem CID | 132758955 |
| Molecular Formula | C30H36IN3O5S |
| Molecular Weight | 677.61 g/mol |
| Exact Mass | 677.14 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3-methoxyphenyl)methyl]amino]-N-butan-2-ylbutanamide |
| SMILES | CCC(C)NC(=O)C(CC)N(Cc1cccc(OC)c1)C(=O)CN(c1ccc(I)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H36IN3O5S/c1-5-22(3)32-30(36)28(6-2)33(20-23-11-10-12-26(19-23)39-4)29(35)21-34(25-17-15-24(31)16-18-25)40(37,38)27-13-8-7-9-14-27/h7-19,22,28H,5-6,20-21H2,1-4H3,(H,32,36) |
| InChIKey | JTBLXASCFZMVHF-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.61 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|