C29H29Cl3F3N3O4S — CID 132758992
2-[[2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-butylpropanamide (PubChem CID 132758992) has the molecular formula C29H29Cl3F3N3O4S and a molecular weight of 678.99 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-butylpropanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 132758992 |
| Molecular Formula | C29H29Cl3F3N3O4S |
| Molecular Weight | 678.99 g/mol |
| Exact Mass | 677.09 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-2-chloro-5-(trifluoromethyl)anilino]acetyl]-[(2,4-dichlorophenyl)methyl]amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccc(Cl)cc1Cl)C(=O)CN(c1cc(C(F)(F)F)ccc1Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H29Cl3F3N3O4S/c1-3-4-14-36-28(40)19(2)37(17-20-10-12-22(30)16-25(20)32)27(39)18-38(43(41,42)23-8-6-5-7-9-23)26-15-21(29(33,34)35)11-13-24(26)31/h5-13,15-16,19H,3-4,14,17-18H2,1-2H3,(H,36,40) |
| InChIKey | OVEZJWLUSFXTQO-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.99 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|