C28H30Cl2IN3O4S — CID 132759458
2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butan-2-ylpropanamide (PubChem CID 132759458) has the molecular formula C28H30Cl2IN3O4S and a molecular weight of 702.44 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butan-2-ylpropanamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butan-2-ylpropanamide |
|---|---|
| PubChem CID | 132759458 |
| Molecular Formula | C28H30Cl2IN3O4S |
| Molecular Weight | 702.44 g/mol |
| Exact Mass | 701.04 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-4-iodoanilino]acetyl]-[(3,4-dichlorophenyl)methyl]amino]-N-butan-2-ylpropanamide |
| SMILES | CCC(C)NC(=O)C(C)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CN(c1ccc(I)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H30Cl2IN3O4S/c1-4-19(2)32-28(36)20(3)33(17-21-10-15-25(29)26(30)16-21)27(35)18-34(23-13-11-22(31)12-14-23)39(37,38)24-8-6-5-7-9-24/h5-16,19-20H,4,17-18H2,1-3H3,(H,32,36) |
| InChIKey | UDFBDGABTFSPBI-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.44 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|