C23H26N2O5 — CID 13276246
diethyl (4R,5S)-1,3-dibenzyl-2-oxoimidazolidine-4,5-dicarboxylate (PubChem CID 13276246) has the molecular formula C23H26N2O5 and a molecular weight of 410.47 g/mol. Its IUPAC name is diethyl (4R,5S)-1,3-dibenzyl-2-oxoimidazolidine-4,5-dicarboxylate.
| Compound Name | diethyl (4R,5S)-1,3-dibenzyl-2-oxoimidazolidine-4,5-dicarboxylate |
|---|---|
| PubChem CID | 13276246 |
| Molecular Formula | C23H26N2O5 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | diethyl (4R,5S)-1,3-dibenzyl-2-oxoimidazolidine-4,5-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H](C(=O)OCC)N(Cc2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C23H26N2O5/c1-3-29-21(26)19-20(22(27)30-4-2)25(16-18-13-9-6-10-14-18)23(28)24(19)15-17-11-7-5-8-12-17/h5-14,19-20H,3-4,15-16H2,1-2H3/t19-,20+ |
| InChIKey | KMDMEAVIRJZGST-BGYRXZFFSA-N |
| XLogP | 2.99 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |