C20H23ClN2O2S — CID 132763140
2-[(2-benzylsulfanylacetyl)-[(3-chlorophenyl)methyl]amino]-N-methylpropanamide (PubChem CID 132763140) has the molecular formula C20H23ClN2O2S and a molecular weight of 390.94 g/mol. Its IUPAC name is 2-[(2-benzylsulfanylacetyl)-[(3-chlorophenyl)methyl]amino]-N-methylpropanamide.
| Compound Name | 2-[(2-benzylsulfanylacetyl)-[(3-chlorophenyl)methyl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 132763140 |
| Molecular Formula | C20H23ClN2O2S |
| Molecular Weight | 390.94 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | 2-[(2-benzylsulfanylacetyl)-[(3-chlorophenyl)methyl]amino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)N(Cc1cccc(Cl)c1)C(=O)CSCc1ccccc1 |
| InChI | InChI=1S/C20H23ClN2O2S/c1-15(20(25)22-2)23(12-17-9-6-10-18(21)11-17)19(24)14-26-13-16-7-4-3-5-8-16/h3-11,15H,12-14H2,1-2H3,(H,22,25) |
| InChIKey | FLFUHFFFGVUCEP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.94 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |