C19H22BrNO3 — CID 132763195
2-(4-bromo-3,5-dimethylphenoxy)-N-[1-(4-methoxyphenyl)ethyl]acetamide (PubChem CID 132763195) has the molecular formula C19H22BrNO3 and a molecular weight of 392.29 g/mol. Its IUPAC name is 2-(4-bromo-3,5-dimethylphenoxy)-N-[1-(4-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(4-bromo-3,5-dimethylphenoxy)-N-[1-(4-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 132763195 |
| Molecular Formula | C19H22BrNO3 |
| Molecular Weight | 392.29 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 2-(4-bromo-3,5-dimethylphenoxy)-N-[1-(4-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(C(C)NC(=O)COc2cc(C)c(Br)c(C)c2)cc1 |
| InChI | InChI=1S/C19H22BrNO3/c1-12-9-17(10-13(2)19(12)20)24-11-18(22)21-14(3)15-5-7-16(23-4)8-6-15/h5-10,14H,11H2,1-4H3,(H,21,22) |
| InChIKey | VOTAJCGVLCSPAA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.29 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |