C13H18ClNO2S — CID 13276420
S-[4-(3-chlorophenoxy)butyl] N,N-dimethylcarbamothioate (PubChem CID 13276420) has the molecular formula C13H18ClNO2S and a molecular weight of 287.81 g/mol. Its IUPAC name is S-[4-(3-chlorophenoxy)butyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-(3-chlorophenoxy)butyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 13276420 |
| Molecular Formula | C13H18ClNO2S |
| Molecular Weight | 287.81 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | S-[4-(3-chlorophenoxy)butyl] N,N-dimethylcarbamothioate |
| SMILES | CN(C)C(=O)SCCCCOc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H18ClNO2S/c1-15(2)13(16)18-9-4-3-8-17-12-7-5-6-11(14)10-12/h5-7,10H,3-4,8-9H2,1-2H3 |
| InChIKey | ORAGKZUNFRSLQN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.81 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|