C21H33N3O2 — CID 132765244
(3S,7R)-2-[[4-hydroxy-1-(2-methylphenyl)piperidin-4-yl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol (PubChem CID 132765244) has the molecular formula C21H33N3O2 and a molecular weight of 359.51 g/mol. Its IUPAC name is (3S,7R)-2-[[4-hydroxy-1-(2-methylphenyl)piperidin-4-yl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol.
| Compound Name | (3S,7R)-2-[[4-hydroxy-1-(2-methylphenyl)piperidin-4-yl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
|---|---|
| PubChem CID | 132765244 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | (3S,7R)-2-[[4-hydroxy-1-(2-methylphenyl)piperidin-4-yl]methyl]-3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-7-ol |
| SMILES | Cc1ccccc1N1CCC(O)(CN2CC3C[C@@H](O)CN3C[C@@H]2C)CC1 |
| InChI | InChI=1S/C21H33N3O2/c1-16-5-3-4-6-20(16)22-9-7-21(26,8-10-22)15-24-13-18-11-19(25)14-23(18)12-17(24)2/h3-6,17-19,25-26H,7-15H2,1-2H3/t17-,18?,19+/m0/s1 |
| InChIKey | BWXMXPGGQLGHTC-LJJQOFDWSA-N |
| XLogP | 1.47 |
| TPSA | 50.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |