C20H20N6OS — CID 132765889
(E)-1-[3-[2-methyl-6-(1,3-thiazol-2-ylamino)pyrimidin-4-yl]pyrrolidin-1-yl]-3-pyridin-3-ylprop-2-en-1-one (PubChem CID 132765889) has the molecular formula C20H20N6OS and a molecular weight of 392.49 g/mol. Its IUPAC name is (E)-1-[3-[2-methyl-6-(1,3-thiazol-2-ylamino)pyrimidin-4-yl]pyrrolidin-1-yl]-3-pyridin-3-ylprop-2-en-1-one.
| Compound Name | (E)-1-[3-[2-methyl-6-(1,3-thiazol-2-ylamino)pyrimidin-4-yl]pyrrolidin-1-yl]-3-pyridin-3-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 132765889 |
| Molecular Formula | C20H20N6OS |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | (E)-1-[3-[2-methyl-6-(1,3-thiazol-2-ylamino)pyrimidin-4-yl]pyrrolidin-1-yl]-3-pyridin-3-ylprop-2-en-1-one |
| SMILES | Cc1nc(Nc2nccs2)cc(C2CCN(C(=O)/C=C/c3cccnc3)C2)n1 |
| InChI | InChI=1S/C20H20N6OS/c1-14-23-17(11-18(24-14)25-20-22-8-10-28-20)16-6-9-26(13-16)19(27)5-4-15-3-2-7-21-12-15/h2-5,7-8,10-12,16H,6,9,13H2,1H3,(H,22,23,24,25)/b5-4+ |
| InChIKey | FFILNVGJUMXIKS-SNAWJCMRSA-N |
| XLogP | 3.41 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|