C26H31NO4 — CID 132766590
N-[(5S,6S,8R,10R)-5-(2-hydroxy-3-methoxyphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]benzamide (PubChem CID 132766590) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is N-[(5S,6S,8R,10R)-5-(2-hydroxy-3-methoxyphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]benzamide.
| Compound Name | N-[(5S,6S,8R,10R)-5-(2-hydroxy-3-methoxyphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]benzamide |
|---|---|
| PubChem CID | 132766590 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | N-[(5S,6S,8R,10R)-5-(2-hydroxy-3-methoxyphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]benzamide |
| SMILES | COc1cccc([C@H]2OCCC34C[C@@H](C[C@H]23)C(C)(C)[C@H]4NC(=O)c2ccccc2)c1O |
| InChI | InChI=1S/C26H31NO4/c1-25(2)17-14-19-22(18-10-7-11-20(30-3)21(18)28)31-13-12-26(19,15-17)24(25)27-23(29)16-8-5-4-6-9-16/h4-11,17,19,22,24,28H,12-15H2,1-3H3,(H,27,29)/t17-,19-,22-,24-,26?/m1/s1 |
| InChIKey | QPDKPJYZEQBIIK-YTOYZRGPSA-N |
| XLogP | 4.71 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |