C21H23BrO5 — CID 132766904
(12a-bromo-1-hydroxy-3-methyl-7,12-dioxo-2,3,4,6,6a,7a,11a,12b-octahydro-1H-benzo[a]anthracen-8-yl) acetate (PubChem CID 132766904) has the molecular formula C21H23BrO5 and a molecular weight of 435.31 g/mol. Its IUPAC name is (12a-bromo-1-hydroxy-3-methyl-7,12-dioxo-2,3,4,6,6a,7a,11a,12b-octahydro-1H-benzo[a]anthracen-8-yl) acetate.
| Compound Name | (12a-bromo-1-hydroxy-3-methyl-7,12-dioxo-2,3,4,6,6a,7a,11a,12b-octahydro-1H-benzo[a]anthracen-8-yl) acetate |
|---|---|
| PubChem CID | 132766904 |
| Molecular Formula | C21H23BrO5 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | (12a-bromo-1-hydroxy-3-methyl-7,12-dioxo-2,3,4,6,6a,7a,11a,12b-octahydro-1H-benzo[a]anthracen-8-yl) acetate |
| SMILES | CC(=O)OC1=CC=CC2C(=O)C3(Br)C(CC=C4CC(C)CC(O)C43)C(=O)C12 |
| InChI | InChI=1S/C21H23BrO5/c1-10-8-12-6-7-14-19(25)17-13(4-3-5-16(17)27-11(2)23)20(26)21(14,22)18(12)15(24)9-10/h3-6,10,13-15,17-18,24H,7-9H2,1-2H3 |
| InChIKey | KLWPLJXBTRGNGN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|