C25H31ClN2O5 — CID 132767978
2-[2-[(4-chlorophenoxy)methyl]-4-[(2-hydroxy-5-methylphenyl)methyl]morpholin-2-yl]-1-morpholin-4-ylethanone (PubChem CID 132767978) has the molecular formula C25H31ClN2O5 and a molecular weight of 474.99 g/mol. Its IUPAC name is 2-[2-[(4-chlorophenoxy)methyl]-4-[(2-hydroxy-5-methylphenyl)methyl]morpholin-2-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[2-[(4-chlorophenoxy)methyl]-4-[(2-hydroxy-5-methylphenyl)methyl]morpholin-2-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 132767978 |
| Molecular Formula | C25H31ClN2O5 |
| Molecular Weight | 474.99 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 2-[2-[(4-chlorophenoxy)methyl]-4-[(2-hydroxy-5-methylphenyl)methyl]morpholin-2-yl]-1-morpholin-4-ylethanone |
| SMILES | Cc1ccc(O)c(CN2CCOC(COc3ccc(Cl)cc3)(CC(=O)N3CCOCC3)C2)c1 |
| InChI | InChI=1S/C25H31ClN2O5/c1-19-2-7-23(29)20(14-19)16-27-8-13-33-25(17-27,15-24(30)28-9-11-31-12-10-28)18-32-22-5-3-21(26)4-6-22/h2-7,14,29H,8-13,15-18H2,1H3 |
| InChIKey | GHNHDZBGYIEJGR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.99 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|