C23H19ClN2O6S — CID 132768281
2-[(4-chlorophenyl)methyl]-2-methyl-N-(3-nitrophenyl)sulfonyl-3H-1-benzofuran-5-carboxamide (PubChem CID 132768281) has the molecular formula C23H19ClN2O6S and a molecular weight of 486.93 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-2-methyl-N-(3-nitrophenyl)sulfonyl-3H-1-benzofuran-5-carboxamide.
| Compound Name | 2-[(4-chlorophenyl)methyl]-2-methyl-N-(3-nitrophenyl)sulfonyl-3H-1-benzofuran-5-carboxamide |
|---|---|
| PubChem CID | 132768281 |
| Molecular Formula | C23H19ClN2O6S |
| Molecular Weight | 486.93 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-2-methyl-N-(3-nitrophenyl)sulfonyl-3H-1-benzofuran-5-carboxamide |
| SMILES | CC1(Cc2ccc(Cl)cc2)Cc2cc(C(=O)NS(=O)(=O)c3cccc([N+](=O)[O-])c3)ccc2O1 |
| InChI | InChI=1S/C23H19ClN2O6S/c1-23(13-15-5-8-18(24)9-6-15)14-17-11-16(7-10-21(17)32-23)22(27)25-33(30,31)20-4-2-3-19(12-20)26(28)29/h2-12H,13-14H2,1H3,(H,25,27) |
| InChIKey | USCALVPNXPYJBC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.93 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|