C10H8N2O2 — CID 13276950
3-phenyl-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-7-one (PubChem CID 13276950) has the molecular formula C10H8N2O2 and a molecular weight of 188.19 g/mol. Its IUPAC name is 3-phenyl-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-7-one.
| Compound Name | 3-phenyl-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-7-one |
|---|---|
| PubChem CID | 13276950 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | 3-phenyl-4-oxa-2,6-diazabicyclo[3.2.0]hept-2-en-7-one |
| SMILES | O=C1NC2OC(c3ccccc3)=NC12 |
| InChI | InChI=1S/C10H8N2O2/c13-8-7-10(12-8)14-9(11-7)6-4-2-1-3-5-6/h1-5,7,10H,(H,12,13) |
| InChIKey | QNNNADMVQUMBHA-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |