About 2-methoxypyridin-3-ol;hydrate
2-methoxypyridin-3-ol;hydrate (PubChem CID 132769884) has the molecular formula C6H9NO3
and a molecular weight of 143.14 g/mol. Its IUPAC name is 2-methoxypyridin-3-ol;hydrate.
Molecular Properties
| Compound Name | 2-methoxypyridin-3-ol;hydrate |
| PubChem CID | 132769884 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | 2-methoxypyridin-3-ol;hydrate |
| SMILES | COc1ncccc1O.O |
| InChI | InChI=1S/C6H7NO2.H2O/c1-9-6-5(8)3-2-4-7-6;/h2-4,8H,1H3;1H2 |
| InChIKey | DUTAEMZYOYHDJZ-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxypyridin-3-ol;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxypyridin-3-ol;hydrate?
The IUPAC name of 2-methoxypyridin-3-ol;hydrate (CID 132769884) is 2-methoxypyridin-3-ol;hydrate.
What is the SMILES notation for 2-methoxypyridin-3-ol;hydrate?
The canonical SMILES for 2-methoxypyridin-3-ol;hydrate is COc1ncccc1O.O.
What is the InChIKey of 2-methoxypyridin-3-ol;hydrate?
The InChIKey is DUTAEMZYOYHDJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2.H2O/c1-9-6-5(8)3-2-4-7-6;/h2-4,8H,1H3;1H2.
What are the key properties of 2-methoxypyridin-3-ol;hydrate?
2-methoxypyridin-3-ol;hydrate has a molecular weight of 143.14 g/mol, XLogP of -0.03, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxypyridin-3-ol;hydrate is sourced from PubChem (CID 132769884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).