C20H30N2O3 — CID 132770566
1-[4-cyclohexyl-6-hydroxy-6-(phenoxymethyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 132770566) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is 1-[4-cyclohexyl-6-hydroxy-6-(phenoxymethyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-cyclohexyl-6-hydroxy-6-(phenoxymethyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 132770566 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | 1-[4-cyclohexyl-6-hydroxy-6-(phenoxymethyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C2CCCCC2)CC(O)(COc2ccccc2)C1 |
| InChI | InChI=1S/C20H30N2O3/c1-17(23)21-12-13-22(18-8-4-2-5-9-18)15-20(24,14-21)16-25-19-10-6-3-7-11-19/h3,6-7,10-11,18,24H,2,4-5,8-9,12-16H2,1H3 |
| InChIKey | LCYSPJSEARODJK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |