About [3-[6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]piperidin-3-yl]methanol
[3-[6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]piperidin-3-yl]methanol (PubChem CID 132771016) has the molecular formula C20H22N4OS
and a molecular weight of 366.49 g/mol. Its IUPAC name is [3-[6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]piperidin-3-yl]methanol.
Molecular Properties
| Compound Name | [3-[6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]piperidin-3-yl]methanol |
| PubChem CID | 132771016 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | [3-[6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]piperidin-3-yl]methanol |
| SMILES | OCC1(c2cccc(Nc3ncc(-c4ccccc4)s3)n2)CCCNC1 |
| InChI | InChI=1S/C20H22N4OS/c25-14-20(10-5-11-21-13-20)17-8-4-9-18(23-17)24-19-22-12-16(26-19)15-6-2-1-3-7-15/h1-4,6-9,12,21,25H,5,10-11,13-14H2,(H,22,23,24) |
| InChIKey | YFTKPTBRWCFDMS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-[6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]piperidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]piperidin-3-yl]methanol?
The IUPAC name of [3-[6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]piperidin-3-yl]methanol (CID 132771016) is [3-[6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]piperidin-3-yl]methanol.
What is the SMILES notation for [3-[6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]piperidin-3-yl]methanol?
The canonical SMILES for [3-[6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]piperidin-3-yl]methanol is OCC1(c2cccc(Nc3ncc(-c4ccccc4)s3)n2)CCCNC1.
What is the InChIKey of [3-[6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]piperidin-3-yl]methanol?
The InChIKey is YFTKPTBRWCFDMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22N4OS/c25-14-20(10-5-11-21-13-20)17-8-4-9-18(23-17)24-19-22-12-16(26-19)15-6-2-1-3-7-15/h1-4,6-9,12,21,25H,5,10-11,13-14H2,(H,22,23,24).
What are the key properties of [3-[6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]piperidin-3-yl]methanol?
[3-[6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]piperidin-3-yl]methanol has a molecular weight of 366.49 g/mol, XLogP of 3.56, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[6-[(5-phenyl-1,3-thiazol-2-yl)amino]-2-pyridinyl]piperidin-3-yl]methanol is sourced from PubChem (CID 132771016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).