About 3,5-dimethyl-1,3-oxazinane
3,5-dimethyl-1,3-oxazinane (PubChem CID 13277333) has the molecular formula C6H13NO
and a molecular weight of 115.18 g/mol. Its IUPAC name is 3,5-dimethyl-1,3-oxazinane.
Molecular Properties
| Compound Name | 3,5-dimethyl-1,3-oxazinane |
| PubChem CID | 13277333 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | 3,5-dimethyl-1,3-oxazinane |
| SMILES | CC1COCN(C)C1 |
| InChI | InChI=1S/C6H13NO/c1-6-3-7(2)5-8-4-6/h6H,3-5H2,1-2H3 |
| InChIKey | RJFSFDWQDQQCGB-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dimethyl-1,3-oxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-1,3-oxazinane?
The IUPAC name of 3,5-dimethyl-1,3-oxazinane (CID 13277333) is 3,5-dimethyl-1,3-oxazinane.
What is the SMILES notation for 3,5-dimethyl-1,3-oxazinane?
The canonical SMILES for 3,5-dimethyl-1,3-oxazinane is CC1COCN(C)C1.
What is the InChIKey of 3,5-dimethyl-1,3-oxazinane?
The InChIKey is RJFSFDWQDQQCGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO/c1-6-3-7(2)5-8-4-6/h6H,3-5H2,1-2H3.
What are the key properties of 3,5-dimethyl-1,3-oxazinane?
3,5-dimethyl-1,3-oxazinane has a molecular weight of 115.18 g/mol, XLogP of 0.54, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-1,3-oxazinane is sourced from PubChem (CID 13277333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).