C21H25ClFNO2 — CID 13277351
1-(4-fluorophenyl)-4-(4-hydroxy-4-phenylpiperidin-1-yl)butan-1-one;hydrochloride (PubChem CID 13277351) has the molecular formula C21H25ClFNO2 and a molecular weight of 377.89 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-(4-hydroxy-4-phenylpiperidin-1-yl)butan-1-one;hydrochloride.
| Compound Name | 1-(4-fluorophenyl)-4-(4-hydroxy-4-phenylpiperidin-1-yl)butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 13277351 |
| Molecular Formula | C21H25ClFNO2 |
| Molecular Weight | 377.89 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 1-(4-fluorophenyl)-4-(4-hydroxy-4-phenylpiperidin-1-yl)butan-1-one;hydrochloride |
| SMILES | Cl.O=C(CCCN1CCC(O)(c2ccccc2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H24FNO2.ClH/c22-19-10-8-17(9-11-19)20(24)7-4-14-23-15-12-21(25,13-16-23)18-5-2-1-3-6-18;/h1-3,5-6,8-11,25H,4,7,12-16H2;1H |
| InChIKey | YFGNTSCYUFZIOL-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.89 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |