C17H29NO2 — CID 132775638
N-[(5R,6S,8R,10R)-5-ethyl-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]propanamide (PubChem CID 132775638) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is N-[(5R,6S,8R,10R)-5-ethyl-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]propanamide.
| Compound Name | N-[(5R,6S,8R,10R)-5-ethyl-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]propanamide |
|---|---|
| PubChem CID | 132775638 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | N-[(5R,6S,8R,10R)-5-ethyl-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]propanamide |
| SMILES | CCC(=O)N[C@@H]1C(C)(C)[C@@H]2C[C@@H]3[C@@H](CC)OCCC31C2 |
| InChI | InChI=1S/C17H29NO2/c1-5-13-12-9-11-10-17(12,7-8-20-13)15(16(11,3)4)18-14(19)6-2/h11-13,15H,5-10H2,1-4H3,(H,18,19)/t11-,12-,13-,15-,17?/m1/s1 |
| InChIKey | OLBBWVUTDSPJSF-PWUXRVMCSA-N |
| XLogP | 3.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |