C21H25NOS — CID 132777133
(1S,2S,4R,5R)-3-methylsulfinyl-2,4-diphenyl-3-azabicyclo[3.3.1]nonane (PubChem CID 132777133) has the molecular formula C21H25NOS and a molecular weight of 339.50 g/mol. Its IUPAC name is (1S,2S,4R,5R)-3-methylsulfinyl-2,4-diphenyl-3-azabicyclo[3.3.1]nonane.
| Compound Name | (1S,2S,4R,5R)-3-methylsulfinyl-2,4-diphenyl-3-azabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 132777133 |
| Molecular Formula | C21H25NOS |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | (1S,2S,4R,5R)-3-methylsulfinyl-2,4-diphenyl-3-azabicyclo[3.3.1]nonane |
| SMILES | CS(=O)N1[C@H](c2ccccc2)[C@H]2CCC[C@H](C2)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C21H25NOS/c1-24(23)22-20(16-9-4-2-5-10-16)18-13-8-14-19(15-18)21(22)17-11-6-3-7-12-17/h2-7,9-12,18-21H,8,13-15H2,1H3/t18-,19+,20+,21-,24? |
| InChIKey | UGRCANBMOJWOOH-QOAZZPQYSA-N |
| XLogP | 4.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |