About 8-amino-2,5-bis(butylamino)-3-chloronaphthalene-1,4-dione
8-amino-2,5-bis(butylamino)-3-chloronaphthalene-1,4-dione (PubChem CID 13277882) has the molecular formula C18H24ClN3O2
and a molecular weight of 349.86 g/mol. Its IUPAC name is 8-amino-2,5-bis(butylamino)-3-chloronaphthalene-1,4-dione.
Molecular Properties
| Compound Name | 8-amino-2,5-bis(butylamino)-3-chloronaphthalene-1,4-dione |
| PubChem CID | 13277882 |
| Molecular Formula | C18H24ClN3O2 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 8-amino-2,5-bis(butylamino)-3-chloronaphthalene-1,4-dione |
| SMILES | CCCCNC1=C(Cl)C(=O)c2c(NCCCC)ccc(N)c2C1=O |
| InChI | InChI=1S/C18H24ClN3O2/c1-3-5-9-21-12-8-7-11(20)13-14(12)17(23)15(19)16(18(13)24)22-10-6-4-2/h7-8,21-22H,3-6,9-10,20H2,1-2H3 |
| InChIKey | UUQHGRJCNSARPS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 8-amino-2,5-bis(butylamino)-3-chloronaphthalene-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-2,5-bis(butylamino)-3-chloronaphthalene-1,4-dione?
The IUPAC name of 8-amino-2,5-bis(butylamino)-3-chloronaphthalene-1,4-dione (CID 13277882) is 8-amino-2,5-bis(butylamino)-3-chloronaphthalene-1,4-dione.
What is the SMILES notation for 8-amino-2,5-bis(butylamino)-3-chloronaphthalene-1,4-dione?
The canonical SMILES for 8-amino-2,5-bis(butylamino)-3-chloronaphthalene-1,4-dione is CCCCNC1=C(Cl)C(=O)c2c(NCCCC)ccc(N)c2C1=O.
What is the InChIKey of 8-amino-2,5-bis(butylamino)-3-chloronaphthalene-1,4-dione?
The InChIKey is UUQHGRJCNSARPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24ClN3O2/c1-3-5-9-21-12-8-7-11(20)13-14(12)17(23)15(19)16(18(13)24)22-10-6-4-2/h7-8,21-22H,3-6,9-10,20H2,1-2H3.
What are the key properties of 8-amino-2,5-bis(butylamino)-3-chloronaphthalene-1,4-dione?
8-amino-2,5-bis(butylamino)-3-chloronaphthalene-1,4-dione has a molecular weight of 349.86 g/mol, XLogP of 3.70, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-2,5-bis(butylamino)-3-chloronaphthalene-1,4-dione is sourced from PubChem (CID 13277882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).