C27H31N3O3 — CID 132779340
[2-(6-benzyl-2-pyridinyl)morpholin-4-yl]-[4-[2-(dimethylamino)ethoxy]phenyl]methanone (PubChem CID 132779340) has the molecular formula C27H31N3O3 and a molecular weight of 445.56 g/mol. Its IUPAC name is [2-(6-benzyl-2-pyridinyl)morpholin-4-yl]-[4-[2-(dimethylamino)ethoxy]phenyl]methanone.
| Compound Name | [2-(6-benzyl-2-pyridinyl)morpholin-4-yl]-[4-[2-(dimethylamino)ethoxy]phenyl]methanone |
|---|---|
| PubChem CID | 132779340 |
| Molecular Formula | C27H31N3O3 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.24 |
| IUPAC Name | [2-(6-benzyl-2-pyridinyl)morpholin-4-yl]-[4-[2-(dimethylamino)ethoxy]phenyl]methanone |
| SMILES | CN(C)CCOc1ccc(C(=O)N2CCOC(c3cccc(Cc4ccccc4)n3)C2)cc1 |
| InChI | InChI=1S/C27H31N3O3/c1-29(2)15-17-32-24-13-11-22(12-14-24)27(31)30-16-18-33-26(20-30)25-10-6-9-23(28-25)19-21-7-4-3-5-8-21/h3-14,26H,15-20H2,1-2H3 |
| InChIKey | SRPFSGABTCCVOV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |