About (2S)-1-fluoropropan-2-ol
(2S)-1-fluoropropan-2-ol (PubChem CID 13278460) has the molecular formula C3H7FO
and a molecular weight of 78.09 g/mol. Its IUPAC name is (2S)-1-fluoropropan-2-ol.
Molecular Properties
| Compound Name | (2S)-1-fluoropropan-2-ol |
| PubChem CID | 13278460 |
| Molecular Formula | C3H7FO |
| Molecular Weight | 78.09 g/mol |
| Exact Mass | 78.05 |
| IUPAC Name | (2S)-1-fluoropropan-2-ol |
| SMILES | C[C@H](O)CF |
| InChI | InChI=1S/C3H7FO/c1-3(5)2-4/h3,5H,2H2,1H3/t3-/m0/s1 |
| InChIKey | WPUWNCWLDZMYSC-VKHMYHEASA-N |
| XLogP | 0.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 78.09 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-1-fluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-1-fluoropropan-2-ol?
The IUPAC name of (2S)-1-fluoropropan-2-ol (CID 13278460) is (2S)-1-fluoropropan-2-ol.
What is the SMILES notation for (2S)-1-fluoropropan-2-ol?
The canonical SMILES for (2S)-1-fluoropropan-2-ol is C[C@H](O)CF.
What is the InChIKey of (2S)-1-fluoropropan-2-ol?
The InChIKey is WPUWNCWLDZMYSC-VKHMYHEASA-N. The full InChI is InChI=1S/C3H7FO/c1-3(5)2-4/h3,5H,2H2,1H3/t3-/m0/s1.
What are the key properties of (2S)-1-fluoropropan-2-ol?
(2S)-1-fluoropropan-2-ol has a molecular weight of 78.09 g/mol, XLogP of 0.34, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-1-fluoropropan-2-ol is sourced from PubChem (CID 13278460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).