About 2-fluorobutylhydrazine
2-fluorobutylhydrazine (PubChem CID 13278470) has the molecular formula C4H11FN2
and a molecular weight of 106.14 g/mol. Its IUPAC name is 2-fluorobutylhydrazine.
Molecular Properties
| Compound Name | 2-fluorobutylhydrazine |
| PubChem CID | 13278470 |
| Molecular Formula | C4H11FN2 |
| Molecular Weight | 106.14 g/mol |
| Exact Mass | 106.09 |
| IUPAC Name | 2-fluorobutylhydrazine |
| SMILES | CCC(F)CNN |
| InChI | InChI=1S/C4H11FN2/c1-2-4(5)3-7-6/h4,7H,2-3,6H2,1H3 |
| InChIKey | TXZUGUFGJAHFHM-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.14 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluorobutylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluorobutylhydrazine?
The IUPAC name of 2-fluorobutylhydrazine (CID 13278470) is 2-fluorobutylhydrazine.
What is the SMILES notation for 2-fluorobutylhydrazine?
The canonical SMILES for 2-fluorobutylhydrazine is CCC(F)CNN.
What is the InChIKey of 2-fluorobutylhydrazine?
The InChIKey is TXZUGUFGJAHFHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11FN2/c1-2-4(5)3-7-6/h4,7H,2-3,6H2,1H3.
What are the key properties of 2-fluorobutylhydrazine?
2-fluorobutylhydrazine has a molecular weight of 106.14 g/mol, XLogP of 0.20, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorobutylhydrazine is sourced from PubChem (CID 13278470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).