About 7-bromo-1,4-dioxaspiro[4.5]dec-6-ene
7-bromo-1,4-dioxaspiro[4.5]dec-6-ene (PubChem CID 13278572) has the molecular formula C8H11BrO2
and a molecular weight of 219.08 g/mol. Its IUPAC name is 7-bromo-1,4-dioxaspiro[4.5]dec-6-ene.
Molecular Properties
| Compound Name | 7-bromo-1,4-dioxaspiro[4.5]dec-6-ene |
| PubChem CID | 13278572 |
| Molecular Formula | C8H11BrO2 |
| Molecular Weight | 219.08 g/mol |
| Exact Mass | 217.99 |
| IUPAC Name | 7-bromo-1,4-dioxaspiro[4.5]dec-6-ene |
| SMILES | BrC1=CC2(CCC1)OCCO2 |
| InChI | InChI=1S/C8H11BrO2/c9-7-2-1-3-8(6-7)10-4-5-11-8/h6H,1-5H2 |
| InChIKey | YIBRYOMRPGYLMU-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.08 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-1,4-dioxaspiro[4.5]dec-6-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1,4-dioxaspiro[4.5]dec-6-ene?
The IUPAC name of 7-bromo-1,4-dioxaspiro[4.5]dec-6-ene (CID 13278572) is 7-bromo-1,4-dioxaspiro[4.5]dec-6-ene.
What is the SMILES notation for 7-bromo-1,4-dioxaspiro[4.5]dec-6-ene?
The canonical SMILES for 7-bromo-1,4-dioxaspiro[4.5]dec-6-ene is BrC1=CC2(CCC1)OCCO2.
What is the InChIKey of 7-bromo-1,4-dioxaspiro[4.5]dec-6-ene?
The InChIKey is YIBRYOMRPGYLMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11BrO2/c9-7-2-1-3-8(6-7)10-4-5-11-8/h6H,1-5H2.
What are the key properties of 7-bromo-1,4-dioxaspiro[4.5]dec-6-ene?
7-bromo-1,4-dioxaspiro[4.5]dec-6-ene has a molecular weight of 219.08 g/mol, XLogP of 2.19, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1,4-dioxaspiro[4.5]dec-6-ene is sourced from PubChem (CID 13278572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).