C28H32O2S — CID 13278723
(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-11-(4-methylsulfanylphenyl)-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 13278723) has the molecular formula C28H32O2S and a molecular weight of 432.63 g/mol. Its IUPAC name is (8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-11-(4-methylsulfanylphenyl)-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-11-(4-methylsulfanylphenyl)-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 13278723 |
| Molecular Formula | C28H32O2S |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | (8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-11-(4-methylsulfanylphenyl)-17-prop-1-ynyl-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC#C[C@]1(O)CC[C@H]2[C@@H]3CCC4=CC(=O)CCC4=C3[C@@H](c3ccc(SC)cc3)C[C@@]21C |
| InChI | InChI=1S/C28H32O2S/c1-4-14-28(30)15-13-25-23-11-7-19-16-20(29)8-12-22(19)26(23)24(17-27(25,28)2)18-5-9-21(31-3)10-6-18/h5-6,9-10,16,23-25,30H,7-8,11-13,15,17H2,1-3H3/t23-,24+,25-,27-,28-/m0/s1 |
| InChIKey | HOENTPHQBWBCJB-WKWWZUSTSA-N |
| XLogP | 6.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|