C18H28N2O3S — CID 132792386
1,3-dicyclohexyl-5-(dimethyl-λ4-sulfanylidene)-1,3-diazinane-2,4,6-trione (PubChem CID 132792386) has the molecular formula C18H28N2O3S and a molecular weight of 352.50 g/mol. Its IUPAC name is 1,3-dicyclohexyl-5-(dimethyl-λ4-sulfanylidene)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1,3-dicyclohexyl-5-(dimethyl-λ4-sulfanylidene)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 132792386 |
| Molecular Formula | C18H28N2O3S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 1,3-dicyclohexyl-5-(dimethyl-λ4-sulfanylidene)-1,3-diazinane-2,4,6-trione |
| SMILES | CS(C)=C1C(=O)N(C2CCCCC2)C(=O)N(C2CCCCC2)C1=O |
| InChI | InChI=1S/C18H28N2O3S/c1-24(2)15-16(21)19(13-9-5-3-6-10-13)18(23)20(17(15)22)14-11-7-4-8-12-14/h13-14H,3-12H2,1-2H3 |
| InChIKey | YLQOWFFABBTDQI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|