C19H17FN2OS2 — CID 132797142
(5E)-3-[(2,3-dimethylanilino)methyl]-5-[(3-fluorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 132797142) has the molecular formula C19H17FN2OS2 and a molecular weight of 372.49 g/mol. Its IUPAC name is (5E)-3-[(2,3-dimethylanilino)methyl]-5-[(3-fluorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-[(2,3-dimethylanilino)methyl]-5-[(3-fluorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 132797142 |
| Molecular Formula | C19H17FN2OS2 |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | (5E)-3-[(2,3-dimethylanilino)methyl]-5-[(3-fluorophenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1cccc(NCN2C(=O)/C(=C\c3cccc(F)c3)SC2=S)c1C |
| InChI | InChI=1S/C19H17FN2OS2/c1-12-5-3-8-16(13(12)2)21-11-22-18(23)17(25-19(22)24)10-14-6-4-7-15(20)9-14/h3-10,21H,11H2,1-2H3/b17-10+ |
| InChIKey | OBZZJOMRKUAABI-LICLKQGHSA-N |
| XLogP | 4.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|