C14H16N4O9S — CID 13279754
(2S,3S,5R)-3-[[4,5-bis(methoxycarbonyl)triazol-1-yl]methyl]-3-methyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 13279754) has the molecular formula C14H16N4O9S and a molecular weight of 416.37 g/mol. Its IUPAC name is (2S,3S,5R)-3-[[4,5-bis(methoxycarbonyl)triazol-1-yl]methyl]-3-methyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,3S,5R)-3-[[4,5-bis(methoxycarbonyl)triazol-1-yl]methyl]-3-methyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 13279754 |
| Molecular Formula | C14H16N4O9S |
| Molecular Weight | 416.37 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | (2S,3S,5R)-3-[[4,5-bis(methoxycarbonyl)triazol-1-yl]methyl]-3-methyl-4,4,7-trioxo-4lambda6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | COC(=O)c1nnn(C[C@@]2(C)[C@H](C(=O)O)N3C(=O)C[C@H]3S2(=O)=O)c1C(=O)OC |
| InChI | InChI=1S/C14H16N4O9S/c1-14(10(11(20)21)18-6(19)4-7(18)28(14,24)25)5-17-9(13(23)27-3)8(15-16-17)12(22)26-2/h7,10H,4-5H2,1-3H3,(H,20,21)/t7-,10+,14+/m1/s1 |
| InChIKey | LODDIIUWELRGMA-IMIVBSTGSA-N |
| XLogP | -1.95 |
| TPSA | 175.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.37 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |