About N-[1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-ethylpentyl]-2-methoxyacetamide
N-[1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-ethylpentyl]-2-methoxyacetamide (PubChem CID 13279955) has the molecular formula C20H29Cl2NO2
and a molecular weight of 386.36 g/mol. Its IUPAC name is N-[1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-ethylpentyl]-2-methoxyacetamide.
Molecular Properties
| Compound Name | N-[1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-ethylpentyl]-2-methoxyacetamide |
| PubChem CID | 13279955 |
| Molecular Formula | C20H29Cl2NO2 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-[1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-ethylpentyl]-2-methoxyacetamide |
| SMILES | CCC(CC)CC(NC(=O)COC)C1(c2ccc(Cl)c(Cl)c2)CCC1 |
| InChI | InChI=1S/C20H29Cl2NO2/c1-4-14(5-2)11-18(23-19(24)13-25-3)20(9-6-10-20)15-7-8-16(21)17(22)12-15/h7-8,12,14,18H,4-6,9-11,13H2,1-3H3,(H,23,24) |
| InChIKey | WMEZJQNYMMYFKS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-ethylpentyl]-2-methoxyacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-ethylpentyl]-2-methoxyacetamide?
The IUPAC name of N-[1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-ethylpentyl]-2-methoxyacetamide (CID 13279955) is N-[1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-ethylpentyl]-2-methoxyacetamide.
What is the SMILES notation for N-[1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-ethylpentyl]-2-methoxyacetamide?
The canonical SMILES for N-[1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-ethylpentyl]-2-methoxyacetamide is CCC(CC)CC(NC(=O)COC)C1(c2ccc(Cl)c(Cl)c2)CCC1.
What is the InChIKey of N-[1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-ethylpentyl]-2-methoxyacetamide?
The InChIKey is WMEZJQNYMMYFKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29Cl2NO2/c1-4-14(5-2)11-18(23-19(24)13-25-3)20(9-6-10-20)15-7-8-16(21)17(22)12-15/h7-8,12,14,18H,4-6,9-11,13H2,1-3H3,(H,23,24).
What are the key properties of N-[1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-ethylpentyl]-2-methoxyacetamide?
N-[1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-ethylpentyl]-2-methoxyacetamide has a molecular weight of 386.36 g/mol, XLogP of 5.37, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[1-(3,4-dichlorophenyl)cyclobutyl]-3-ethylpentyl]-2-methoxyacetamide is sourced from PubChem (CID 13279955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).